C21H23F3N4O3 — CID 166935727
(5S)-5-cyclopropyl-5-[3-oxo-3-[7-(trifluoromethyl)-3,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-2-yl]propyl]imidazolidine-2,4-dione (PubChem CID 166935727) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is (5S)-5-cyclopropyl-5-[3-oxo-3-[7-(trifluoromethyl)-3,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-2-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclopropyl-5-[3-oxo-3-[7-(trifluoromethyl)-3,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-2-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166935727 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (5S)-5-cyclopropyl-5-[3-oxo-3-[7-(trifluoromethyl)-3,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-2-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](CCC(=O)N2CCN3c4cc(C(F)(F)F)ccc4CC3C2)(C2CC2)N1 |
| InChI | InChI=1S/C21H23F3N4O3/c22-21(23,24)14-2-1-12-9-15-11-27(7-8-28(15)16(12)10-14)17(29)5-6-20(13-3-4-13)18(30)25-19(31)26-20/h1-2,10,13,15H,3-9,11H2,(H2,25,26,30,31)/t15?,20-/m0/s1 |
| InChIKey | IRHSJDCOUVWQBW-MBABXSBOSA-N |
| XLogP | 2.05 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|