C18H24N6O3 — CID 121437664
5-cyclopropyl-5-[3-[(3S)-3-methyl-4-pyrimidin-5-ylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 121437664) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is 5-cyclopropyl-5-[3-[(3S)-3-methyl-4-pyrimidin-5-ylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-5-[3-[(3S)-3-methyl-4-pyrimidin-5-ylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121437664 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 5-cyclopropyl-5-[3-[(3S)-3-methyl-4-pyrimidin-5-ylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)CCC2(C3CC3)NC(=O)NC2=O)CCN1c1cncnc1 |
| InChI | InChI=1S/C18H24N6O3/c1-12-10-23(6-7-24(12)14-8-19-11-20-9-14)15(25)4-5-18(13-2-3-13)16(26)21-17(27)22-18/h8-9,11-13H,2-7,10H2,1H3,(H2,21,22,26,27)/t12-,18?/m0/s1 |
| InChIKey | LEFBQNFCJPFJDM-RSXQAXDFSA-N |
| XLogP | 0.28 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|