C18H22F2N4O3 — CID 121437573
5-[3-[(3S)-4-(3,4-difluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 121437573) has the molecular formula C18H22F2N4O3 and a molecular weight of 380.40 g/mol. Its IUPAC name is 5-[3-[(3S)-4-(3,4-difluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[(3S)-4-(3,4-difluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121437573 |
| Molecular Formula | C18H22F2N4O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-[3-[(3S)-4-(3,4-difluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)CCC2(C)NC(=O)NC2=O)CCN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H22F2N4O3/c1-11-10-23(7-8-24(11)12-3-4-13(19)14(20)9-12)15(25)5-6-18(2)16(26)21-17(27)22-18/h3-4,9,11H,5-8,10H2,1-2H3,(H2,21,22,26,27)/t11-,18?/m0/s1 |
| InChIKey | BMHXOFMSBQNQPB-FAQQKDIKSA-N |
| XLogP | 1.38 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|