C19H24FN3O3 — CID 147941137
3-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 147941137) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 147941137 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | C[C@H]1CN(C(=O)CCC2(C)CC(=O)NC2=O)CCN1c1cccc(F)c1 |
| InChI | InChI=1S/C19H24FN3O3/c1-13-12-22(8-9-23(13)15-5-3-4-14(20)10-15)17(25)6-7-19(2)11-16(24)21-18(19)26/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,21,24,26)/t13-,19?/m0/s1 |
| InChIKey | ILTUXGINESYUBV-YTJLLHSVSA-N |
| XLogP | 1.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|