C23H28N4O3 — CID 147066350
5-cyclopropyl-5-[3-[(3S)-4-(1H-isoindol-5-yl)-3-methylpiperazin-1-yl]-3-oxopropyl]pyrrolidine-2,4-dione (PubChem CID 147066350) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 5-cyclopropyl-5-[3-[(3S)-4-(1H-isoindol-5-yl)-3-methylpiperazin-1-yl]-3-oxopropyl]pyrrolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-5-[3-[(3S)-4-(1H-isoindol-5-yl)-3-methylpiperazin-1-yl]-3-oxopropyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 147066350 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 5-cyclopropyl-5-[3-[(3S)-4-(1H-isoindol-5-yl)-3-methylpiperazin-1-yl]-3-oxopropyl]pyrrolidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)CCC2(C3CC3)NC(=O)CC2=O)CCN1c1ccc2c(c1)C=NC2 |
| InChI | InChI=1S/C23H28N4O3/c1-15-14-26(8-9-27(15)19-5-2-16-12-24-13-17(16)10-19)22(30)6-7-23(18-3-4-18)20(28)11-21(29)25-23/h2,5,10,13,15,18H,3-4,6-9,11-12,14H2,1H3,(H,25,29)/t15-,23?/m0/s1 |
| InChIKey | BEEADLDAJGATHD-NGMICRHFSA-N |
| XLogP | 1.67 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|