C25H26N4O3 — CID 24888270
5-ethyl-5-[2-oxo-2-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 24888270) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-ethyl-5-[2-oxo-2-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-[2-oxo-2-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24888270 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-ethyl-5-[2-oxo-2-[4-[4-(2-phenylethynyl)phenyl]piperazin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC(=O)N2CCN(c3ccc(C#Cc4ccccc4)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C25H26N4O3/c1-2-25(23(31)26-24(32)27-25)18-22(30)29-16-14-28(15-17-29)21-12-10-20(11-13-21)9-8-19-6-4-3-5-7-19/h3-7,10-13H,2,14-18H2,1H3,(H2,26,27,31,32) |
| InChIKey | PRKNPLQGDMAXEN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|