C19H23Cl2N5O4 — CID 174993219
3-[4-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 174993219) has the molecular formula C19H23Cl2N5O4 and a molecular weight of 456.33 g/mol. Its IUPAC name is 3-[4-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | 3-[4-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 174993219 |
| Molecular Formula | C19H23Cl2N5O4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[4-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | NC(=O)CCC1(CCC(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H23Cl2N5O4/c20-12-9-13(21)11-14(10-12)25-5-7-26(8-6-25)16(28)2-4-19(3-1-15(22)27)17(29)23-18(30)24-19/h9-11H,1-8H2,(H2,22,27)(H2,23,24,29,30) |
| InChIKey | SGMFTBSVMJFHLU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|