C19H19Cl2N5O4 — CID 137468089
5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-(1,3-oxazol-4-yl)imidazolidine-2,4-dione (PubChem CID 137468089) has the molecular formula C19H19Cl2N5O4 and a molecular weight of 452.30 g/mol. Its IUPAC name is 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-(1,3-oxazol-4-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-(1,3-oxazol-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137468089 |
| Molecular Formula | C19H19Cl2N5O4 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-(1,3-oxazol-4-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)(c2cocn2)N1 |
| InChI | InChI=1S/C19H19Cl2N5O4/c20-12-7-13(21)9-14(8-12)25-3-5-26(6-4-25)16(27)1-2-19(15-10-30-11-22-15)17(28)23-18(29)24-19/h7-11H,1-6H2,(H2,23,24,28,29) |
| InChIKey | DCYFMGUTYIOSEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|