C19H16Cl2N4O3 — CID 156823207
5-[3-(5,6-dichloro-1,3-dihydroisoindol-2-yl)-3-oxopropyl]-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 156823207) has the molecular formula C19H16Cl2N4O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is 5-[3-(5,6-dichloro-1,3-dihydroisoindol-2-yl)-3-oxopropyl]-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[3-(5,6-dichloro-1,3-dihydroisoindol-2-yl)-3-oxopropyl]-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156823207 |
| Molecular Formula | C19H16Cl2N4O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 5-[3-(5,6-dichloro-1,3-dihydroisoindol-2-yl)-3-oxopropyl]-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2Cc3cc(Cl)c(Cl)cc3C2)(c2ccccn2)N1 |
| InChI | InChI=1S/C19H16Cl2N4O3/c20-13-7-11-9-25(10-12(11)8-14(13)21)16(26)4-5-19(15-3-1-2-6-22-15)17(27)23-18(28)24-19/h1-3,6-8H,4-5,9-10H2,(H2,23,24,27,28) |
| InChIKey | RZYRWVVQRWYGNG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|