C24H32N2 — CID 137468073
N-ethenyl-N'-(2-methylphenyl)-N'-[5-(4-methylphenyl)hex-5-enyl]ethane-1,2-diamine (PubChem CID 137468073) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N-ethenyl-N'-(2-methylphenyl)-N'-[5-(4-methylphenyl)hex-5-enyl]ethane-1,2-diamine.
| Compound Name | N-ethenyl-N'-(2-methylphenyl)-N'-[5-(4-methylphenyl)hex-5-enyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 137468073 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-ethenyl-N'-(2-methylphenyl)-N'-[5-(4-methylphenyl)hex-5-enyl]ethane-1,2-diamine |
| SMILES | C=CNCCN(CCCCC(=C)c1ccc(C)cc1)c1ccccc1C |
| InChI | InChI=1S/C24H32N2/c1-5-25-17-19-26(24-12-7-6-11-22(24)4)18-9-8-10-21(3)23-15-13-20(2)14-16-23/h5-7,11-16,25H,1,3,8-10,17-19H2,2,4H3 |
| InChIKey | XNDIFGMEBCCBGO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|