C22H26 — CID 15247721
1-methyl-4-[7-(4-methylphenyl)octa-1,7-dien-2-yl]benzene (PubChem CID 15247721) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-methyl-4-[7-(4-methylphenyl)octa-1,7-dien-2-yl]benzene.
| Compound Name | 1-methyl-4-[7-(4-methylphenyl)octa-1,7-dien-2-yl]benzene |
|---|---|
| PubChem CID | 15247721 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-methyl-4-[7-(4-methylphenyl)octa-1,7-dien-2-yl]benzene |
| SMILES | C=C(CCCCC(=C)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26/c1-17-9-13-21(14-10-17)19(3)7-5-6-8-20(4)22-15-11-18(2)12-16-22/h9-16H,3-8H2,1-2H3 |
| InChIKey | IAXHPRYDGXELBG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|