C23H40 — CID 143117352
2,5-dimethylhex-1-ene;ethane;1-hex-1-en-2-yl-4-methylbenzene (PubChem CID 143117352) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2,5-dimethylhex-1-ene;ethane;1-hex-1-en-2-yl-4-methylbenzene.
| Compound Name | 2,5-dimethylhex-1-ene;ethane;1-hex-1-en-2-yl-4-methylbenzene |
|---|---|
| PubChem CID | 143117352 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 2,5-dimethylhex-1-ene;ethane;1-hex-1-en-2-yl-4-methylbenzene |
| SMILES | C=C(C)CCC(C)C.C=C(CCCC)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C13H18.C8H16.C2H6/c1-4-5-6-12(3)13-9-7-11(2)8-10-13;1-7(2)5-6-8(3)4;1-2/h7-10H,3-6H2,1-2H3;8H,1,5-6H2,2-4H3;1-2H3 |
| InChIKey | BELXCMMQCBEOJW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|