C16H22 — CID 143865907
1-methyl-4-(7-methylocta-1,7-dien-2-yl)benzene (PubChem CID 143865907) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-methyl-4-(7-methylocta-1,7-dien-2-yl)benzene.
| Compound Name | 1-methyl-4-(7-methylocta-1,7-dien-2-yl)benzene |
|---|---|
| PubChem CID | 143865907 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-methyl-4-(7-methylocta-1,7-dien-2-yl)benzene |
| SMILES | C=C(C)CCCCC(=C)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22/c1-13(2)7-5-6-8-15(4)16-11-9-14(3)10-12-16/h9-12H,1,4-8H2,2-3H3 |
| InChIKey | ALXFSQUDFJJADW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|