C22H24FN3O3 — CID 137471192
4-[4-(azetidin-3-ylmethoxy)-1-(oxan-2-yl)indazol-6-yl]-2-fluorophenol (PubChem CID 137471192) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 4-[4-(azetidin-3-ylmethoxy)-1-(oxan-2-yl)indazol-6-yl]-2-fluorophenol.
| Compound Name | 4-[4-(azetidin-3-ylmethoxy)-1-(oxan-2-yl)indazol-6-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 137471192 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[4-(azetidin-3-ylmethoxy)-1-(oxan-2-yl)indazol-6-yl]-2-fluorophenol |
| SMILES | Oc1ccc(-c2cc(OCC3CNC3)c3cnn(C4CCCCO4)c3c2)cc1F |
| InChI | InChI=1S/C22H24FN3O3/c23-18-7-15(4-5-20(18)27)16-8-19-17(21(9-16)29-13-14-10-24-11-14)12-25-26(19)22-3-1-2-6-28-22/h4-5,7-9,12,14,22,24,27H,1-3,6,10-11,13H2 |
| InChIKey | FYUREWOIPJSDJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |