C21H23F2N5O3 — CID 137472389
(1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-pyridin-2-yloxycyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate (PubChem CID 137472389) has the molecular formula C21H23F2N5O3 and a molecular weight of 431.44 g/mol. Its IUPAC name is (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-pyridin-2-yloxycyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate.
| Compound Name | (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-pyridin-2-yloxycyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 137472389 |
| Molecular Formula | C21H23F2N5O3 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-pyridin-2-yloxycyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
| SMILES | [H]/N=C(/OC(N)C(F)F)c1cnc2c(c1)C(=O)N(C1CCCC[C@H]1Oc1ccccn1)C2 |
| InChI | InChI=1S/C21H23F2N5O3/c22-18(23)20(25)31-19(24)12-9-13-14(27-10-12)11-28(21(13)29)15-5-1-2-6-16(15)30-17-7-3-4-8-26-17/h3-4,7-10,15-16,18,20,24H,1-2,5-6,11,25H2/b24-19+/t15?,16-,20?/m1/s1 |
| InChIKey | UBGSTYGFUAERAD-VKESELLBSA-N |
| XLogP | 2.71 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|