C21H26F5N5O3 — CID 137472417
(1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]cyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate (PubChem CID 137472417) has the molecular formula C21H26F5N5O3 and a molecular weight of 491.46 g/mol. Its IUPAC name is (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]cyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate.
| Compound Name | (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]cyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 137472417 |
| Molecular Formula | C21H26F5N5O3 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | (1-amino-2,2-difluoroethyl) 5-oxo-6-[(2R)-2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]cyclohexyl]-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
| SMILES | [H]/N=C(/OC(N)C(F)F)c1cnc2c(c1)C(=O)N(C1CCCC[C@H]1NC(=O)C(C)(C)C(F)(F)F)C2 |
| InChI | InChI=1S/C21H26F5N5O3/c1-20(2,21(24,25)26)19(33)30-12-5-3-4-6-14(12)31-9-13-11(18(31)32)7-10(8-29-13)16(27)34-17(28)15(22)23/h7-8,12,14-15,17,27H,3-6,9,28H2,1-2H3,(H,30,33)/b27-16+/t12-,14?,17?/m1/s1 |
| InChIKey | ZBMSZFDWJSPNPM-ORVPMDKNSA-N |
| XLogP | 2.95 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|