C22H28F3N3O6S — CID 137472519
N-[butoxy(hydroxy)methyl]-2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 137472519) has the molecular formula C22H28F3N3O6S and a molecular weight of 519.54 g/mol. Its IUPAC name is N-[butoxy(hydroxy)methyl]-2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[butoxy(hydroxy)methyl]-2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 137472519 |
| Molecular Formula | C22H28F3N3O6S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-[butoxy(hydroxy)methyl]-2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCCCOC(O)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1-c1ccc(CN2CCOCC2)cn1 |
| InChI | InChI=1S/C22H28F3N3O6S/c1-2-3-10-33-21(29)27-35(30,31)20-7-5-17(34-22(23,24)25)13-18(20)19-6-4-16(14-26-19)15-28-8-11-32-12-9-28/h4-7,13-14,21,27,29H,2-3,8-12,15H2,1H3 |
| InChIKey | ZZSGLKWWBQQXRN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|