C43H26FN5 — CID 137472731
5-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-fluorobenzo[b][1,10]phenanthroline (PubChem CID 137472731) has the molecular formula C43H26FN5 and a molecular weight of 631.71 g/mol. Its IUPAC name is 5-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-fluorobenzo[b][1,10]phenanthroline.
| Compound Name | 5-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-fluorobenzo[b][1,10]phenanthroline |
|---|---|
| PubChem CID | 137472731 |
| Molecular Formula | C43H26FN5 |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 5-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9-fluorobenzo[b][1,10]phenanthroline |
| SMILES | Fc1ccc2nc3c(cc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)c4cccnc43)cc2c1 |
| InChI | InChI=1S/C43H26FN5/c44-35-19-20-38-33(25-35)24-34-26-37(36-18-9-21-45-40(36)39(34)46-38)31-16-7-14-29(22-31)30-15-8-17-32(23-30)43-48-41(27-10-3-1-4-11-27)47-42(49-43)28-12-5-2-6-13-28/h1-26H |
| InChIKey | XWMUWTIFIQDMFE-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|