C24H30ClN9O3S — CID 137473003
2-[(2R)-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 137473003) has the molecular formula C24H30ClN9O3S and a molecular weight of 560.08 g/mol. Its IUPAC name is 2-[(2R)-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R)-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137473003 |
| Molecular Formula | C24H30ClN9O3S |
| Molecular Weight | 560.08 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[(2R)-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)[C@H](CCCCN=C(N)N)NC(=O)c1csc([C@H]2CCCN2C(=O)c2cn3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C24H30ClN9O3S/c1-28-20(35)15(5-2-3-9-29-24(26)27)31-21(36)17-13-38-22(32-17)18-6-4-10-34(18)23(37)16-12-33-11-14(25)7-8-19(33)30-16/h7-8,11-13,15,18H,2-6,9-10H2,1H3,(H,28,35)(H,31,36)(H4,26,27,29)/t15-,18+/m0/s1 |
| InChIKey | JYHRVUUCZYFFGN-MAUKXSAKSA-N |
| XLogP | 1.71 |
| TPSA | 173.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|