C36H54N2P2+2 — CID 137473522
4-[diphenyl(3-phenylphosphanylpropyl)phosphaniumyl]butyl-dimethyl-(2,2,6,6-tetramethylpiperidin-4-yl)azanium (PubChem CID 137473522) has the molecular formula C36H54N2P2+2 and a molecular weight of 576.79 g/mol. Its IUPAC name is 4-[diphenyl(3-phenylphosphanylpropyl)phosphaniumyl]butyl-dimethyl-(2,2,6,6-tetramethylpiperidin-4-yl)azanium.
| Compound Name | 4-[diphenyl(3-phenylphosphanylpropyl)phosphaniumyl]butyl-dimethyl-(2,2,6,6-tetramethylpiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 137473522 |
| Molecular Formula | C36H54N2P2+2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 4-[diphenyl(3-phenylphosphanylpropyl)phosphaniumyl]butyl-dimethyl-(2,2,6,6-tetramethylpiperidin-4-yl)azanium |
| SMILES | CC1(C)CC([N+](C)(C)CCCC[P+](CCCPc2ccccc2)(c2ccccc2)c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C36H54N2P2/c1-35(2)29-31(30-36(3,4)37-35)38(5,6)25-16-17-27-40(33-21-12-8-13-22-33,34-23-14-9-15-24-34)28-18-26-39-32-19-10-7-11-20-32/h7-15,19-24,31,37,39H,16-18,25-30H2,1-6H3/q+2 |
| InChIKey | XZWFETMIOIKUHZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|