About 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid
9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid (PubChem CID 137480427) has the molecular formula C8H12F2N2O2
and a molecular weight of 206.19 g/mol. Its IUPAC name is 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid.
Analyze 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid?
The IUPAC name of 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid (CID 137480427) is 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid.
What is the SMILES notation for 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid?
The canonical SMILES for 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid is O=C(O)N1CC2CNCC(C1)C2(F)F.
What is the InChIKey of 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid?
The InChIKey is LYHJALDDXKUKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O2/c9-8(10)5-1-11-2-6(8)4-12(3-5)7(13)14/h5-6,11H,1-4H2,(H,13,14).
What are the key properties of 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid?
9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid has a molecular weight of 206.19 g/mol, XLogP of 0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-difluoro-3,7-diazabicyclo[3.3.1]nonane-3-carboxylic acid is sourced from PubChem (CID 137480427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).