C18H25N7O — CID 137481303
6-(2-morpholin-4-ylphenyl)-5-piperazin-1-ylpyrimidine-2,4-diamine (PubChem CID 137481303) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylphenyl)-5-piperazin-1-ylpyrimidine-2,4-diamine.
| Compound Name | 6-(2-morpholin-4-ylphenyl)-5-piperazin-1-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 137481303 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 6-(2-morpholin-4-ylphenyl)-5-piperazin-1-ylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c(N2CCNCC2)c(-c2ccccc2N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N7O/c19-17-16(25-7-5-21-6-8-25)15(22-18(20)23-17)13-3-1-2-4-14(13)24-9-11-26-12-10-24/h1-4,21H,5-12H2,(H4,19,20,22,23) |
| InChIKey | ZJJUJTCHKPSZQH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |