C26H28N6O — CID 137482037
2-[[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenyl]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137482037) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenyl]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenyl]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137482037 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenyl]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CN(c1ccc(Cc2nc3cnccc3c(=O)[nH]2)cc1)c1ccc(N2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C26H28N6O/c1-31(21-6-8-22(9-7-21)32-14-11-19(27)12-15-32)20-4-2-18(3-5-20)16-25-29-24-17-28-13-10-23(24)26(33)30-25/h2-10,13,17,19H,11-12,14-16,27H2,1H3,(H,29,30,33) |
| InChIKey | CJCOTNZEYZWMSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|