C25H28N6O2 — CID 118960655
2-[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenoxy]-1H-pyrido[3,4-d]pyrimidin-2-ol (PubChem CID 118960655) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenoxy]-1H-pyrido[3,4-d]pyrimidin-2-ol.
| Compound Name | 2-[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenoxy]-1H-pyrido[3,4-d]pyrimidin-2-ol |
|---|---|
| PubChem CID | 118960655 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-[4-[4-(4-aminopiperidin-1-yl)-N-methylanilino]phenoxy]-1H-pyrido[3,4-d]pyrimidin-2-ol |
| SMILES | CN(c1ccc(OC2(O)N=Cc3ccncc3N2)cc1)c1ccc(N2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C25H28N6O2/c1-30(20-2-4-22(5-3-20)31-14-11-19(26)12-15-31)21-6-8-23(9-7-21)33-25(32)28-16-18-10-13-27-17-24(18)29-25/h2-10,13,16-17,19,29,32H,11-12,14-15,26H2,1H3 |
| InChIKey | RYNDBTOIQJIXMQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|