C10H12N4 — CID 67060660
4-[(3S)-3-aminopyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 67060660) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-[(3S)-3-aminopyrrolidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 4-[(3S)-3-aminopyrrolidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67060660 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-[(3S)-3-aminopyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnccc1N1CC[C@H](N)C1 |
| InChI | InChI=1S/C10H12N4/c11-5-8-6-13-3-1-10(8)14-4-2-9(12)7-14/h1,3,6,9H,2,4,7,12H2/t9-/m0/s1 |
| InChIKey | ABCASGICFOISMS-VIFPVBQESA-N |
| XLogP | 0.49 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |