C12H13N3O2 — CID 114287746
methyl 1-(4-cyano-3-pyridinyl)pyrrolidine-3-carboxylate (PubChem CID 114287746) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 1-(4-cyano-3-pyridinyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-cyano-3-pyridinyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 114287746 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | methyl 1-(4-cyano-3-pyridinyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(c2cnccc2C#N)C1 |
| InChI | InChI=1S/C12H13N3O2/c1-17-12(16)10-3-5-15(8-10)11-7-14-4-2-9(11)6-13/h2,4,7,10H,3,5,8H2,1H3 |
| InChIKey | OZJNHTPNDIXDEJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |