C12H15N3O — CID 115883813
3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]pyridine-4-carbonitrile (PubChem CID 115883813) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 115883813 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1N1CCC(CCO)C1 |
| InChI | InChI=1S/C12H15N3O/c13-7-11-1-4-14-8-12(11)15-5-2-10(9-15)3-6-16/h1,4,8,10,16H,2-3,5-6,9H2 |
| InChIKey | SJWCMUZXDMBCAQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |