C29H45NO2S — CID 137483285
N-[[(1S,5R)-8-(8,8-dimethyl-4-oxononyl)-3-bicyclo[3.2.1]octanyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137483285) has the molecular formula C29H45NO2S and a molecular weight of 471.75 g/mol. Its IUPAC name is N-[[(1S,5R)-8-(8,8-dimethyl-4-oxononyl)-3-bicyclo[3.2.1]octanyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[[(1S,5R)-8-(8,8-dimethyl-4-oxononyl)-3-bicyclo[3.2.1]octanyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137483285 |
| Molecular Formula | C29H45NO2S |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | N-[[(1S,5R)-8-(8,8-dimethyl-4-oxononyl)-3-bicyclo[3.2.1]octanyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)CCCC(=O)CCCC1[C@@H]2CC[C@H]1CC(CNC(=O)c1csc3c1CCCC3)C2 |
| InChI | InChI=1S/C29H45NO2S/c1-29(2,3)15-7-9-23(31)8-6-11-24-21-13-14-22(24)17-20(16-21)18-30-28(32)26-19-33-27-12-5-4-10-25(26)27/h19-22,24H,4-18H2,1-3H3,(H,30,32)/t20?,21-,22+,24? |
| InChIKey | NFCZGZCQHGGARE-NPXOOMFISA-N |
| XLogP | 7.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |