C15H23NOS2 — CID 20881787
N-(3-propylsulfanylpropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 20881787) has the molecular formula C15H23NOS2 and a molecular weight of 297.49 g/mol. Its IUPAC name is N-(3-propylsulfanylpropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(3-propylsulfanylpropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 20881787 |
| Molecular Formula | C15H23NOS2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(3-propylsulfanylpropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCSCCCNC(=O)c1csc2c1CCCC2 |
| InChI | InChI=1S/C15H23NOS2/c1-2-9-18-10-5-8-16-15(17)13-11-19-14-7-4-3-6-12(13)14/h11H,2-10H2,1H3,(H,16,17) |
| InChIKey | CRSSQEMTPIOGOV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|