C19H31N3OS — CID 3244633
N-[3-(4-ethylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 3244633) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3244633 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2csc3c2CCCCC3)CC1 |
| InChI | InChI=1S/C19H31N3OS/c1-2-21-11-13-22(14-12-21)10-6-9-20-19(23)17-15-24-18-8-5-3-4-7-16(17)18/h15H,2-14H2,1H3,(H,20,23) |
| InChIKey | MEDNNPLNMHHDHL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|