C16H35NO3 — CID 137483974
(4R)-9-[methyl(2-methylpentyl)amino]nonane-1,4,6-triol (PubChem CID 137483974) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is (4R)-9-[methyl(2-methylpentyl)amino]nonane-1,4,6-triol.
| Compound Name | (4R)-9-[methyl(2-methylpentyl)amino]nonane-1,4,6-triol |
|---|---|
| PubChem CID | 137483974 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | (4R)-9-[methyl(2-methylpentyl)amino]nonane-1,4,6-triol |
| SMILES | CCCC(C)CN(C)CCCC(O)C[C@H](O)CCCO |
| InChI | InChI=1S/C16H35NO3/c1-4-7-14(2)13-17(3)10-5-8-15(19)12-16(20)9-6-11-18/h14-16,18-20H,4-13H2,1-3H3/t14?,15?,16-/m1/s1 |
| InChIKey | UTCZGGQRNKQANF-UYSNPLJNSA-N |
| XLogP | 2.02 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |