C49H33N7 — CID 137484488
5-[3-[4-naphthalen-2-yl-6-[(2E,4E)-5-(1,10-phenanthrolin-5-yl)hexa-2,4-dien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 137484488) has the molecular formula C49H33N7 and a molecular weight of 719.85 g/mol. Its IUPAC name is 5-[3-[4-naphthalen-2-yl-6-[(2E,4E)-5-(1,10-phenanthrolin-5-yl)hexa-2,4-dien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-[4-naphthalen-2-yl-6-[(2E,4E)-5-(1,10-phenanthrolin-5-yl)hexa-2,4-dien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 137484488 |
| Molecular Formula | C49H33N7 |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.28 |
| IUPAC Name | 5-[3-[4-naphthalen-2-yl-6-[(2E,4E)-5-(1,10-phenanthrolin-5-yl)hexa-2,4-dien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | C/C=C(\C=C(/C)c1cc2cccnc2c2ncccc12)c1nc(-c2cccc(-c3cc4cccnc4c4ncccc34)c2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C49H33N7/c1-3-31(25-30(2)41-28-35-15-7-21-50-43(35)45-39(41)17-9-23-52-45)47-54-48(56-49(55-47)38-20-19-32-11-4-5-12-33(32)26-38)37-14-6-13-34(27-37)42-29-36-16-8-22-51-44(36)46-40(42)18-10-24-53-46/h3-29H,1-2H3/b30-25+,31-3+ |
| InChIKey | SLDNZYSZQKSMRN-YJABTSGSSA-N |
| XLogP | 11.73 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|