C23H24ClN7O2 — CID 137485095
methyl 8-chloro-1-(1-pyrimidin-2-ylpiperidin-4-yl)spiro[6H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-4,1'-cyclopropane]-5-carboxylate (PubChem CID 137485095) has the molecular formula C23H24ClN7O2 and a molecular weight of 465.95 g/mol. Its IUPAC name is methyl 8-chloro-1-(1-pyrimidin-2-ylpiperidin-4-yl)spiro[6H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-4,1'-cyclopropane]-5-carboxylate.
| Compound Name | methyl 8-chloro-1-(1-pyrimidin-2-ylpiperidin-4-yl)spiro[6H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-4,1'-cyclopropane]-5-carboxylate |
|---|---|
| PubChem CID | 137485095 |
| Molecular Formula | C23H24ClN7O2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | methyl 8-chloro-1-(1-pyrimidin-2-ylpiperidin-4-yl)spiro[6H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-4,1'-cyclopropane]-5-carboxylate |
| SMILES | COC(=O)N1Cc2cc(Cl)ccc2-n2c(C3CCN(c4ncccn4)CC3)nnc2C12CC2 |
| InChI | InChI=1S/C23H24ClN7O2/c1-33-22(32)30-14-16-13-17(24)3-4-18(16)31-19(27-28-20(31)23(30)7-8-23)15-5-11-29(12-6-15)21-25-9-2-10-26-21/h2-4,9-10,13,15H,5-8,11-12,14H2,1H3 |
| InChIKey | OHBNXHTYTJMVCI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |