C23H21ClF2N6O — CID 137485130
1-[8-chloro-1-(2-pyridin-2-yl-2-azaspiro[3.3]heptan-6-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]-2,2-difluoroethanone (PubChem CID 137485130) has the molecular formula C23H21ClF2N6O and a molecular weight of 470.91 g/mol. Its IUPAC name is 1-[8-chloro-1-(2-pyridin-2-yl-2-azaspiro[3.3]heptan-6-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]-2,2-difluoroethanone.
| Compound Name | 1-[8-chloro-1-(2-pyridin-2-yl-2-azaspiro[3.3]heptan-6-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 137485130 |
| Molecular Formula | C23H21ClF2N6O |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[8-chloro-1-(2-pyridin-2-yl-2-azaspiro[3.3]heptan-6-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1Cc2cc(Cl)ccc2-n2c(nnc2C2CC3(C2)CN(c2ccccn2)C3)C1 |
| InChI | InChI=1S/C23H21ClF2N6O/c24-16-4-5-17-14(7-16)10-30(22(33)20(25)26)11-19-28-29-21(32(17)19)15-8-23(9-15)12-31(13-23)18-3-1-2-6-27-18/h1-7,15,20H,8-13H2 |
| InChIKey | OHFBEKWPXQKKII-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |