C24H24ClF3N6 — CID 137485610
8-chloro-1-[2-(4-methyl-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485610) has the molecular formula C24H24ClF3N6 and a molecular weight of 488.95 g/mol. Its IUPAC name is 8-chloro-1-[2-(4-methyl-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[2-(4-methyl-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485610 |
| Molecular Formula | C24H24ClF3N6 |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 8-chloro-1-[2-(4-methyl-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Cc1ccnc(N2CC3(CC(c4nnc5n4-c4ccc(Cl)cc4CN(CC(F)(F)F)C5)C3)C2)c1 |
| InChI | InChI=1S/C24H24ClF3N6/c1-15-4-5-29-20(6-15)33-12-23(13-33)8-17(9-23)22-31-30-21-11-32(14-24(26,27)28)10-16-7-18(25)2-3-19(16)34(21)22/h2-7,17H,8-14H2,1H3 |
| InChIKey | BPNWEWKFRUDZMJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |