C22H23ClF3N7 — CID 137486020
8-chloro-1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137486020) has the molecular formula C22H23ClF3N7 and a molecular weight of 477.92 g/mol. Its IUPAC name is 8-chloro-1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137486020 |
| Molecular Formula | C22H23ClF3N7 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 8-chloro-1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Cc1ccnc(N2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(CC(F)(F)F)C4)CC2)n1 |
| InChI | InChI=1S/C22H23ClF3N7/c1-14-4-7-27-21(28-14)32-8-5-15(6-9-32)20-30-29-19-12-31(13-22(24,25)26)11-16-10-17(23)2-3-18(16)33(19)20/h2-4,7,10,15H,5-6,8-9,11-13H2,1H3 |
| InChIKey | XWDLZLABXMCOOF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |