C23H20ClF7N6 — CID 137485781
8-chloro-1-[1-[6-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485781) has the molecular formula C23H20ClF7N6 and a molecular weight of 548.89 g/mol. Its IUPAC name is 8-chloro-1-[1-[6-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[1-[6-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485781 |
| Molecular Formula | C23H20ClF7N6 |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 8-chloro-1-[1-[6-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Fc1nc(N2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(CC(F)(F)F)C4)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C23H20ClF7N6/c24-15-1-3-17-14(9-15)10-35(12-22(26,27)28)11-19-33-34-21(37(17)19)13-5-7-36(8-6-13)18-4-2-16(20(25)32-18)23(29,30)31/h1-4,9,13H,5-8,10-12H2 |
| InChIKey | AHKMTLWTAOVTDT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|