C23H22ClF4N7 — CID 167389624
8-chloro-1-[6-(6-fluoro-5-methyl-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389624) has the molecular formula C23H22ClF4N7 and a molecular weight of 507.92 g/mol. Its IUPAC name is 8-chloro-1-[6-(6-fluoro-5-methyl-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[6-(6-fluoro-5-methyl-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389624 |
| Molecular Formula | C23H22ClF4N7 |
| Molecular Weight | 507.92 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 8-chloro-1-[6-(6-fluoro-5-methyl-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Cc1ccc(N2CC3(C2)CN(c2nnc4n2-c2ccc(Cl)cc2CN(CC(F)(F)F)C4)C3)nc1F |
| InChI | InChI=1S/C23H22ClF4N7/c1-14-2-5-18(29-20(14)25)33-9-22(10-33)11-34(12-22)21-31-30-19-8-32(13-23(26,27)28)7-15-6-16(24)3-4-17(15)35(19)21/h2-6H,7-13H2,1H3 |
| InChIKey | IABMRNSRZOLDIG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|