C24H24ClF3N6O2S — CID 137486428
3-[8-chloro-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]thietane 1,1-dioxide (PubChem CID 137486428) has the molecular formula C24H24ClF3N6O2S and a molecular weight of 553.01 g/mol. Its IUPAC name is 3-[8-chloro-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]thietane 1,1-dioxide.
| Compound Name | 3-[8-chloro-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]thietane 1,1-dioxide |
|---|---|
| PubChem CID | 137486428 |
| Molecular Formula | C24H24ClF3N6O2S |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 3-[8-chloro-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]thietane 1,1-dioxide |
| SMILES | O=S1(=O)CC(N2Cc3cc(Cl)ccc3-n3c(nnc3C3CCN(c4cccc(C(F)(F)F)n4)CC3)C2)C1 |
| InChI | InChI=1S/C24H24ClF3N6O2S/c25-17-4-5-19-16(10-17)11-33(18-13-37(35,36)14-18)12-22-30-31-23(34(19)22)15-6-8-32(9-7-15)21-3-1-2-20(29-21)24(26,27)28/h1-5,10,15,18H,6-9,11-14H2 |
| InChIKey | SQQDDLNEFJCUBY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |