C25H28ClFN6O — CID 137486517
8-chloro-1-[1-(3-fluoro-6-methyl-2-pyridinyl)piperidin-4-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137486517) has the molecular formula C25H28ClFN6O and a molecular weight of 482.99 g/mol. Its IUPAC name is 8-chloro-1-[1-(3-fluoro-6-methyl-2-pyridinyl)piperidin-4-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[1-(3-fluoro-6-methyl-2-pyridinyl)piperidin-4-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137486517 |
| Molecular Formula | C25H28ClFN6O |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 8-chloro-1-[1-(3-fluoro-6-methyl-2-pyridinyl)piperidin-4-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Cc1ccc(F)c(N2CCC(c3nnc4n3-c3ccc(Cl)cc3CN([C@H]3CCOC3)C4)CC2)n1 |
| InChI | InChI=1S/C25H28ClFN6O/c1-16-2-4-21(27)25(28-16)31-9-6-17(7-10-31)24-30-29-23-14-32(20-8-11-34-15-20)13-18-12-19(26)3-5-22(18)33(23)24/h2-5,12,17,20H,6-11,13-15H2,1H3/t20-/m0/s1 |
| InChIKey | WGXVQXQGDXHSRE-FQEVSTJZSA-N |
| XLogP | 4.25 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |