C26H27ClF2N6O2 — CID 167389237
8-chloro-1-[6-(2,4-difluoro-5-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389237) has the molecular formula C26H27ClF2N6O2 and a molecular weight of 528.99 g/mol. Its IUPAC name is 8-chloro-1-[6-(2,4-difluoro-5-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[6-(2,4-difluoro-5-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389237 |
| Molecular Formula | C26H27ClF2N6O2 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 8-chloro-1-[6-(2,4-difluoro-5-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | COc1cc(N2CC3(C2)CN(c2nnc4n2-c2ccc(Cl)cc2CN([C@H]2CCOC2)C4)C3)c(F)cc1F |
| InChI | InChI=1S/C26H27ClF2N6O2/c1-36-23-8-22(19(28)7-20(23)29)33-12-26(13-33)14-34(15-26)25-31-30-24-10-32(18-4-5-37-11-18)9-16-6-17(27)2-3-21(16)35(24)25/h2-3,6-8,18H,4-5,9-15H2,1H3/t18-/m0/s1 |
| InChIKey | FPLWXBRMIGZLBW-SFHVURJKSA-N |
| XLogP | 3.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |