C23H25ClN8O — CID 167389460
8-chloro-5-[(3R)-oxolan-3-yl]-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389460) has the molecular formula C23H25ClN8O and a molecular weight of 464.96 g/mol. Its IUPAC name is 8-chloro-5-[(3R)-oxolan-3-yl]-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-[(3R)-oxolan-3-yl]-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389460 |
| Molecular Formula | C23H25ClN8O |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 8-chloro-5-[(3R)-oxolan-3-yl]-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)CN([C@@H]1CCOC1)Cc1nnc(N3CC4(CN(c5cnccn5)C4)C3)n1-2 |
| InChI | InChI=1S/C23H25ClN8O/c24-17-1-2-19-16(7-17)9-29(18-3-6-33-11-18)10-21-27-28-22(32(19)21)31-14-23(15-31)12-30(13-23)20-8-25-4-5-26-20/h1-2,4-5,7-8,18H,3,6,9-15H2/t18-/m1/s1 |
| InChIKey | YYRLITZZNFPFHS-GOSISDBHSA-N |
| XLogP | 2.14 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |