C22H22ClN9 — CID 167389776
2-[8-chloro-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]propanenitrile (PubChem CID 167389776) has the molecular formula C22H22ClN9 and a molecular weight of 447.93 g/mol. Its IUPAC name is 2-[8-chloro-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]propanenitrile.
| Compound Name | 2-[8-chloro-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]propanenitrile |
|---|---|
| PubChem CID | 167389776 |
| Molecular Formula | C22H22ClN9 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[8-chloro-1-(6-pyrazin-2-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl]propanenitrile |
| SMILES | CC(C#N)N1Cc2cc(Cl)ccc2-n2c(nnc2N2CC3(CN(c4cnccn4)C3)C2)C1 |
| InChI | InChI=1S/C22H22ClN9/c1-15(7-24)29-9-16-6-17(23)2-3-18(16)32-20(10-29)27-28-21(32)31-13-22(14-31)11-30(12-22)19-8-25-4-5-26-19/h2-6,8,15H,9-14H2,1H3 |
| InChIKey | RBTRPBMHPJEJJD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |