C20H21ClN8 — CID 167389246
8-chloro-5-methyl-1-(6-pyridazin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389246) has the molecular formula C20H21ClN8 and a molecular weight of 408.90 g/mol. Its IUPAC name is 8-chloro-5-methyl-1-(6-pyridazin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-methyl-1-(6-pyridazin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389246 |
| Molecular Formula | C20H21ClN8 |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 8-chloro-5-methyl-1-(6-pyridazin-3-yl-2,6-diazaspiro[3.3]heptan-2-yl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | CN1Cc2cc(Cl)ccc2-n2c(nnc2N2CC3(CN(c4cccnn4)C3)C2)C1 |
| InChI | InChI=1S/C20H21ClN8/c1-26-8-14-7-15(21)4-5-16(14)29-18(9-26)24-25-19(29)28-12-20(13-28)10-27(11-20)17-3-2-6-22-23-17/h2-7H,8-13H2,1H3 |
| InChIKey | RLCQNBOXLIVBSV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |