C23H23ClFN7 — CID 167389819
8-chloro-5-cyclopropyl-1-[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389819) has the molecular formula C23H23ClFN7 and a molecular weight of 451.94 g/mol. Its IUPAC name is 8-chloro-5-cyclopropyl-1-[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-cyclopropyl-1-[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389819 |
| Molecular Formula | C23H23ClFN7 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 8-chloro-5-cyclopropyl-1-[6-(3-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Fc1cccnc1N1CC2(C1)CN(c1nnc3n1-c1ccc(Cl)cc1CN(C1CC1)C3)C2 |
| InChI | InChI=1S/C23H23ClFN7/c24-16-3-6-19-15(8-16)9-29(17-4-5-17)10-20-27-28-22(32(19)20)31-13-23(14-31)11-30(12-23)21-18(25)2-1-7-26-21/h1-3,6-8,17H,4-5,9-14H2 |
| InChIKey | IBCDDURBIABJHR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |