C24H24ClF2N7O — CID 167389418
8-chloro-1-[6-(3,5-difluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 167389418) has the molecular formula C24H24ClF2N7O and a molecular weight of 499.95 g/mol. Its IUPAC name is 8-chloro-1-[6-(3,5-difluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[6-(3,5-difluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 167389418 |
| Molecular Formula | C24H24ClF2N7O |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 8-chloro-1-[6-(3,5-difluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-5-[(3S)-oxolan-3-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Fc1cnc(N2CC3(C2)CN(c2nnc4n2-c2ccc(Cl)cc2CN([C@H]2CCOC2)C4)C3)c(F)c1 |
| InChI | InChI=1S/C24H24ClF2N7O/c25-16-1-2-20-15(5-16)8-31(18-3-4-35-10-18)9-21-29-30-23(34(20)21)33-13-24(14-33)11-32(12-24)22-19(27)6-17(26)7-28-22/h1-2,5-7,18H,3-4,8-14H2/t18-/m0/s1 |
| InChIKey | MYWVLUVXCBNDBU-SFHVURJKSA-N |
| XLogP | 3.03 |
| TPSA | 62.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |