C26H26ClF3N6O — CID 137486622
8-chloro-5-[(3S)-oxolan-3-yl]-1-[2-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137486622) has the molecular formula C26H26ClF3N6O and a molecular weight of 530.98 g/mol. Its IUPAC name is 8-chloro-5-[(3S)-oxolan-3-yl]-1-[2-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-[(3S)-oxolan-3-yl]-1-[2-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137486622 |
| Molecular Formula | C26H26ClF3N6O |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 8-chloro-5-[(3S)-oxolan-3-yl]-1-[2-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | FC(F)(F)c1cccc(N2CC3(CC(c4nnc5n4-c4ccc(Cl)cc4CN([C@H]4CCOC4)C5)C3)C2)n1 |
| InChI | InChI=1S/C26H26ClF3N6O/c27-18-4-5-20-16(8-18)11-34(19-6-7-37-13-19)12-23-32-33-24(36(20)23)17-9-25(10-17)14-35(15-25)22-3-1-2-21(31-22)26(28,29)30/h1-5,8,17,19H,6-7,9-15H2/t19-/m0/s1 |
| InChIKey | YAIYKJDOCYRWBF-IBGZPJMESA-N |
| XLogP | 4.82 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |