C24H26ClF3N6 — CID 137485740
8-chloro-1-[1-(4,6-dimethyl-2-pyridinyl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485740) has the molecular formula C24H26ClF3N6 and a molecular weight of 490.96 g/mol. Its IUPAC name is 8-chloro-1-[1-(4,6-dimethyl-2-pyridinyl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[1-(4,6-dimethyl-2-pyridinyl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485740 |
| Molecular Formula | C24H26ClF3N6 |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 8-chloro-1-[1-(4,6-dimethyl-2-pyridinyl)piperidin-4-yl]-5-(2,2,2-trifluoroethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Cc1cc(C)nc(N2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(CC(F)(F)F)C4)CC2)c1 |
| InChI | InChI=1S/C24H26ClF3N6/c1-15-9-16(2)29-21(10-15)33-7-5-17(6-8-33)23-31-30-22-13-32(14-24(26,27)28)12-18-11-19(25)3-4-20(18)34(22)23/h3-4,9-11,17H,5-8,12-14H2,1-2H3 |
| InChIKey | CRROKAFMWUIKEG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |