C24H24ClFN8O — CID 137485868
2-[4-[8-chloro-5-[(3-fluorooxetan-3-yl)methyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]piperidin-1-yl]pyrimidine-4-carbonitrile (PubChem CID 137485868) has the molecular formula C24H24ClFN8O and a molecular weight of 494.96 g/mol. Its IUPAC name is 2-[4-[8-chloro-5-[(3-fluorooxetan-3-yl)methyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]piperidin-1-yl]pyrimidine-4-carbonitrile.
| Compound Name | 2-[4-[8-chloro-5-[(3-fluorooxetan-3-yl)methyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]piperidin-1-yl]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 137485868 |
| Molecular Formula | C24H24ClFN8O |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[4-[8-chloro-5-[(3-fluorooxetan-3-yl)methyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]piperidin-1-yl]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(CC3(F)COC3)C4)CC2)n1 |
| InChI | InChI=1S/C24H24ClFN8O/c25-18-1-2-20-17(9-18)11-32(13-24(26)14-35-15-24)12-21-30-31-22(34(20)21)16-4-7-33(8-5-16)23-28-6-3-19(10-27)29-23/h1-3,6,9,16H,4-5,7-8,11-15H2 |
| InChIKey | DLJQEVLAYJGKRY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |