C39H51NO7 — CID 137490702
1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl (2S,4R)-4-[6-(cyclodecyloxymethyl)oxan-2-yl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 137490702) has the molecular formula C39H51NO7 and a molecular weight of 645.84 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl (2S,4R)-4-[6-(cyclodecyloxymethyl)oxan-2-yl]oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl (2S,4R)-4-[6-(cyclodecyloxymethyl)oxan-2-yl]oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 137490702 |
| Molecular Formula | C39H51NO7 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl (2S,4R)-4-[6-(cyclodecyloxymethyl)oxan-2-yl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C[C@@H](OC2CCCC(COC3CCCCCCCCC3)O2)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H51NO7/c1-2-23-43-38(41)36-24-30(47-37-22-14-17-29(46-37)26-44-28-15-8-6-4-3-5-7-9-16-28)25-40(36)39(42)45-27-35-33-20-12-10-18-31(33)32-19-11-13-21-34(32)35/h2,10-13,18-21,28-30,35-37H,1,3-9,14-17,22-27H2/t29?,30-,36+,37?/m1/s1 |
| InChIKey | XYYCTPXRFBVFQA-HNZICXDPSA-N |
| XLogP | 7.93 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|